C13H17NS — CID 11435940
1-isothiocyanato-2,4-di(propan-2-yl)benzene (PubChem CID 11435940) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 1-isothiocyanato-2,4-di(propan-2-yl)benzene.
| Compound Name | 1-isothiocyanato-2,4-di(propan-2-yl)benzene |
|---|---|
| PubChem CID | 11435940 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 1-isothiocyanato-2,4-di(propan-2-yl)benzene |
| SMILES | CC(C)c1ccc(N=C=S)c(C(C)C)c1 |
| InChI | InChI=1S/C13H17NS/c1-9(2)11-5-6-13(14-8-15)12(7-11)10(3)4/h5-7,9-10H,1-4H3 |
| InChIKey | CSHMYGKZKHKJPU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|