C15H17F3N2 — CID 114490261
2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-indole (PubChem CID 114490261) has the molecular formula C15H17F3N2 and a molecular weight of 282.31 g/mol. Its IUPAC name is 2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-indole.
| Compound Name | 2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 114490261 |
| Molecular Formula | C15H17F3N2 |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | 2-[[4-(trifluoromethyl)-3,6-dihydro-2H-pyridin-1-yl]methyl]-2,3-dihydro-1H-indole |
| SMILES | FC(F)(F)C1=CCN(CC2Cc3ccccc3N2)CC1 |
| InChI | InChI=1S/C15H17F3N2/c16-15(17,18)12-5-7-20(8-6-12)10-13-9-11-3-1-2-4-14(11)19-13/h1-5,13,19H,6-10H2 |
| InChIKey | QSQBUSZYAOHOQE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|