C19H24O5 — CID 11450392
diethyl (1S,5R,8S)-2-methylidene-12-oxotricyclo[6.3.1.01,5]dodec-9-ene-4,4-dicarboxylate (PubChem CID 11450392) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is diethyl (1S,5R,8S)-2-methylidene-12-oxotricyclo[6.3.1.01,5]dodec-9-ene-4,4-dicarboxylate.
| Compound Name | diethyl (1S,5R,8S)-2-methylidene-12-oxotricyclo[6.3.1.01,5]dodec-9-ene-4,4-dicarboxylate |
|---|---|
| PubChem CID | 11450392 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | diethyl (1S,5R,8S)-2-methylidene-12-oxotricyclo[6.3.1.01,5]dodec-9-ene-4,4-dicarboxylate |
| SMILES | C=C1CC(C(=O)OCC)(C(=O)OCC)[C@@H]2CC[C@H]3C=CC[C@@]12C3=O |
| InChI | InChI=1S/C19H24O5/c1-4-23-16(21)19(17(22)24-5-2)11-12(3)18-10-6-7-13(15(18)20)8-9-14(18)19/h6-7,13-14H,3-5,8-11H2,1-2H3/t13-,14-,18-/m1/s1 |
| InChIKey | IQXDRVONZRWZIW-HBUWYVDXSA-N |
| XLogP | 2.60 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|