C6H8ClNS — CID 114749344
2-chloro-4,5-dimethylthiophen-3-amine (PubChem CID 114749344) has the molecular formula C6H8ClNS and a molecular weight of 161.66 g/mol. Its IUPAC name is 2-chloro-4,5-dimethylthiophen-3-amine.
| Compound Name | 2-chloro-4,5-dimethylthiophen-3-amine |
|---|---|
| PubChem CID | 114749344 |
| Molecular Formula | C6H8ClNS |
| Molecular Weight | 161.66 g/mol |
| Exact Mass | 161.01 |
| IUPAC Name | 2-chloro-4,5-dimethylthiophen-3-amine |
| SMILES | Cc1sc(Cl)c(N)c1C |
| InChI | InChI=1S/C6H8ClNS/c1-3-4(2)9-6(7)5(3)8/h8H2,1-2H3 |
| InChIKey | UTTPQGLNPVOXHY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.66 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |