C21H34I2O2 — CID 11478665
(1'R,4'aR,5'R,8'aS)-5'-[(2R)-1-iodo-3-methylbutan-2-yl]-1'-[(2S)-1-iodopropan-2-yl]-7'-methylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene] (PubChem CID 11478665) has the molecular formula C21H34I2O2 and a molecular weight of 572.31 g/mol. Its IUPAC name is (1'R,4'aR,5'R,8'aS)-5'-[(2R)-1-iodo-3-methylbutan-2-yl]-1'-[(2S)-1-iodopropan-2-yl]-7'-methylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene].
| Compound Name | (1'R,4'aR,5'R,8'aS)-5'-[(2R)-1-iodo-3-methylbutan-2-yl]-1'-[(2S)-1-iodopropan-2-yl]-7'-methylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene] |
|---|---|
| PubChem CID | 11478665 |
| Molecular Formula | C21H34I2O2 |
| Molecular Weight | 572.31 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | (1'R,4'aR,5'R,8'aS)-5'-[(2R)-1-iodo-3-methylbutan-2-yl]-1'-[(2S)-1-iodopropan-2-yl]-7'-methylspiro[1,3-dioxolane-2,3'-2,4,4a,5,6,8a-hexahydro-1H-naphthalene] |
| SMILES | CC1=C[C@@H]2[C@H]([C@H](C)CI)CC3(C[C@@H]2[C@H]([C@H](CI)C(C)C)C1)OCCO3 |
| InChI | InChI=1S/C21H34I2O2/c1-13(2)20(12-23)17-8-14(3)7-16-18(15(4)11-22)9-21(10-19(16)17)24-5-6-25-21/h7,13,15-20H,5-6,8-12H2,1-4H3/t15-,16-,17-,18+,19+,20-/m1/s1 |
| InChIKey | YTEOYNZRQZBYCO-QONVVCGCSA-N |
| XLogP | 6.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.31 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|