C29H22ClN7O5S — CID 11479060
(3R,3aR)-6-[5-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-(2,4-dinitrophenyl)-N-methyl-3-phenyl-3,3a-dihydropyrazolo[3,4-d][1,3]thiazol-5-imine (PubChem CID 11479060) has the molecular formula C29H22ClN7O5S and a molecular weight of 616.06 g/mol. Its IUPAC name is (3R,3aR)-6-[5-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-(2,4-dinitrophenyl)-N-methyl-3-phenyl-3,3a-dihydropyrazolo[3,4-d][1,3]thiazol-5-imine.
| Compound Name | (3R,3aR)-6-[5-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-(2,4-dinitrophenyl)-N-methyl-3-phenyl-3,3a-dihydropyrazolo[3,4-d][1,3]thiazol-5-imine |
|---|---|
| PubChem CID | 11479060 |
| Molecular Formula | C29H22ClN7O5S |
| Molecular Weight | 616.06 g/mol |
| Exact Mass | 615.11 |
| IUPAC Name | (3R,3aR)-6-[5-[(E)-2-(4-chlorophenyl)ethenyl]-3-methyl-1,2-oxazol-4-yl]-2-(2,4-dinitrophenyl)-N-methyl-3-phenyl-3,3a-dihydropyrazolo[3,4-d][1,3]thiazol-5-imine |
| SMILES | C/N=C1\S[C@H]2C(=NN(c3ccc([N+](=O)[O-])cc3[N+](=O)[O-])[C@@H]2c2ccccc2)N1c1c(C)noc1/C=C/c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H22ClN7O5S/c1-17-25(24(42-33-17)15-10-18-8-11-20(30)12-9-18)34-28-27(43-29(34)31-2)26(19-6-4-3-5-7-19)35(32-28)22-14-13-21(36(38)39)16-23(22)37(40)41/h3-16,26-27H,1-2H3/b15-10+,31-29-/t26-,27-/m1/s1 |
| InChIKey | JEMWBFOWYYNKRK-UXCKNRFTSA-N |
| XLogP | 7.11 |
| TPSA | 143.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.06 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|