C6H10F3N3O2S — CID 114807831
4-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile (PubChem CID 114807831) has the molecular formula C6H10F3N3O2S and a molecular weight of 245.23 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile.
| Compound Name | 4-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
|---|---|
| PubChem CID | 114807831 |
| Molecular Formula | C6H10F3N3O2S |
| Molecular Weight | 245.23 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 4-(2,2,2-trifluoroethylsulfamoylamino)butanenitrile |
| SMILES | N#CCCCNS(=O)(=O)NCC(F)(F)F |
| InChI | InChI=1S/C6H10F3N3O2S/c7-6(8,9)5-12-15(13,14)11-4-2-1-3-10/h11-12H,1-2,4-5H2 |
| InChIKey | AYFOWAZYDZWEQK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.23 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|