C21H19N5O2S — CID 11486552
methyl N-cyano-N'-(1,3-dibenzyl-2,6-dioxopyrimidin-4-yl)carbamimidothioate (PubChem CID 11486552) has the molecular formula C21H19N5O2S and a molecular weight of 405.48 g/mol. Its IUPAC name is methyl N-cyano-N'-(1,3-dibenzyl-2,6-dioxopyrimidin-4-yl)carbamimidothioate.
| Compound Name | methyl N-cyano-N'-(1,3-dibenzyl-2,6-dioxopyrimidin-4-yl)carbamimidothioate |
|---|---|
| PubChem CID | 11486552 |
| Molecular Formula | C21H19N5O2S |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | methyl N-cyano-N'-(1,3-dibenzyl-2,6-dioxopyrimidin-4-yl)carbamimidothioate |
| SMILES | CS/C(=N\c1cc(=O)n(Cc2ccccc2)c(=O)n1Cc1ccccc1)NC#N |
| InChI | InChI=1S/C21H19N5O2S/c1-29-20(23-15-22)24-18-12-19(27)26(14-17-10-6-3-7-11-17)21(28)25(18)13-16-8-4-2-5-9-16/h2-12H,13-14H2,1H3,(H,23,24) |
| InChIKey | ZHPWCSNBJMLROP-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|