C28H27N3O3 — CID 11487831
10-[3-(2-hydroxyethylamino)propylamino]-12-methyl-16-phenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione (PubChem CID 11487831) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is 10-[3-(2-hydroxyethylamino)propylamino]-12-methyl-16-phenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione.
| Compound Name | 10-[3-(2-hydroxyethylamino)propylamino]-12-methyl-16-phenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
|---|---|
| PubChem CID | 11487831 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | 10-[3-(2-hydroxyethylamino)propylamino]-12-methyl-16-phenyl-14-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9,11,13(17)-heptaene-8,15-dione |
| SMILES | Cc1cc(NCCCNCCO)c2c3c(c(-c4ccccc4)c(=O)[nH]c13)-c1ccccc1C2=O |
| InChI | InChI=1S/C28H27N3O3/c1-17-16-21(30-13-7-12-29-14-15-32)24-25-23(19-10-5-6-11-20(19)27(24)33)22(28(34)31-26(17)25)18-8-3-2-4-9-18/h2-6,8-11,16,29-30,32H,7,12-15H2,1H3,(H,31,34) |
| InChIKey | PHYVWWOEQISHII-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|