C26H39N3O5 — CID 11488312
(2R,3R)-5-[(2R,4S)-5-azido-4-methylpentan-2-yl]-5-methoxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-3-ol (PubChem CID 11488312) has the molecular formula C26H39N3O5 and a molecular weight of 473.61 g/mol. Its IUPAC name is (2R,3R)-5-[(2R,4S)-5-azido-4-methylpentan-2-yl]-5-methoxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-3-ol.
| Compound Name | (2R,3R)-5-[(2R,4S)-5-azido-4-methylpentan-2-yl]-5-methoxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-3-ol |
|---|---|
| PubChem CID | 11488312 |
| Molecular Formula | C26H39N3O5 |
| Molecular Weight | 473.61 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | (2R,3R)-5-[(2R,4S)-5-azido-4-methylpentan-2-yl]-5-methoxy-2-[(1S,3S)-1-[(4-methoxyphenyl)methoxy]-3-methylhex-5-ynyl]oxolan-3-ol |
| SMILES | C#CC[C@H](C)C[C@H](OCc1ccc(OC)cc1)[C@@H]1OC(OC)([C@H](C)C[C@H](C)CN=[N+]=[N-])C[C@H]1O |
| InChI | InChI=1S/C26H39N3O5/c1-7-8-18(2)14-24(33-17-21-9-11-22(31-5)12-10-21)25-23(30)15-26(32-6,34-25)20(4)13-19(3)16-28-29-27/h1,9-12,18-20,23-25,30H,8,13-17H2,2-6H3/t18-,19-,20+,23+,24-,25+,26?/m0/s1 |
| InChIKey | VMFVMHVGAPSAKC-QBIZPBBDSA-N |
| XLogP | 5.09 |
| TPSA | 105.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.61 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|