C26H24O4S — CID 11502918
dimethyl (1S,2R,5S,6R)-3-(4-methylphenyl)sulfanyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-7,8-dicarboxylate (PubChem CID 11502918) has the molecular formula C26H24O4S and a molecular weight of 432.54 g/mol. Its IUPAC name is dimethyl (1S,2R,5S,6R)-3-(4-methylphenyl)sulfanyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-7,8-dicarboxylate.
| Compound Name | dimethyl (1S,2R,5S,6R)-3-(4-methylphenyl)sulfanyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-7,8-dicarboxylate |
|---|---|
| PubChem CID | 11502918 |
| Molecular Formula | C26H24O4S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | dimethyl (1S,2R,5S,6R)-3-(4-methylphenyl)sulfanyl-4-phenyltricyclo[4.2.1.02,5]nona-3,7-diene-7,8-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@@H]2C[C@H]1[C@H]1C(Sc3ccc(C)cc3)=C(c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C26H24O4S/c1-14-9-11-16(12-10-14)31-24-19(15-7-5-4-6-8-15)20-17-13-18(21(20)24)23(26(28)30-3)22(17)25(27)29-2/h4-12,17-18,20-21H,13H2,1-3H3/t17-,18+,20-,21-/m1/s1 |
| InChIKey | LEYJKBFTUXYTCO-KOUHRCEDSA-N |
| XLogP | 5.04 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |