C16H15ClN2O2 — CID 11514982
1,2,3,4-tetrahydroquinolin-6-yl N-(2-chlorophenyl)carbamate (PubChem CID 11514982) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 1,2,3,4-tetrahydroquinolin-6-yl N-(2-chlorophenyl)carbamate.
| Compound Name | 1,2,3,4-tetrahydroquinolin-6-yl N-(2-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 11514982 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 1,2,3,4-tetrahydroquinolin-6-yl N-(2-chlorophenyl)carbamate |
| SMILES | O=C(Nc1ccccc1Cl)Oc1ccc2c(c1)CCCN2 |
| InChI | InChI=1S/C16H15ClN2O2/c17-13-5-1-2-6-15(13)19-16(20)21-12-7-8-14-11(10-12)4-3-9-18-14/h1-2,5-8,10,18H,3-4,9H2,(H,19,20) |
| InChIKey | KCTCLSDBDRUWKY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |