C15H17F8O8PS — CID 11519513
(2-diethoxyphosphoryl-4-methoxyphenyl) 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonate (PubChem CID 11519513) has the molecular formula C15H17F8O8PS and a molecular weight of 540.32 g/mol. Its IUPAC name is (2-diethoxyphosphoryl-4-methoxyphenyl) 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonate.
| Compound Name | (2-diethoxyphosphoryl-4-methoxyphenyl) 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonate |
|---|---|
| PubChem CID | 11519513 |
| Molecular Formula | C15H17F8O8PS |
| Molecular Weight | 540.32 g/mol |
| Exact Mass | 540.03 |
| IUPAC Name | (2-diethoxyphosphoryl-4-methoxyphenyl) 1,1,2,2-tetrafluoro-2-(1,1,2,2-tetrafluoroethoxy)ethanesulfonate |
| SMILES | CCOP(=O)(OCC)c1cc(OC)ccc1OS(=O)(=O)C(F)(F)C(F)(F)OC(F)(F)C(F)F |
| InChI | InChI=1S/C15H17F8O8PS/c1-4-28-32(24,29-5-2)11-8-9(27-3)6-7-10(11)30-33(25,26)15(22,23)14(20,21)31-13(18,19)12(16)17/h6-8,12H,4-5H2,1-3H3 |
| InChIKey | HCVBERRRFBVQGK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.32 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|