C29H34N4O8 — CID 11534241
1-O-[2-[(1R)-1-(3-amino-4-oxoquinazolin-2-yl)ethoxy]ethyl] 7-O-methyl (6S)-2-methylidene-6-(phenylmethoxycarbonylamino)heptanedioate (PubChem CID 11534241) has the molecular formula C29H34N4O8 and a molecular weight of 566.61 g/mol. Its IUPAC name is 1-O-[2-[(1R)-1-(3-amino-4-oxoquinazolin-2-yl)ethoxy]ethyl] 7-O-methyl (6S)-2-methylidene-6-(phenylmethoxycarbonylamino)heptanedioate.
| Compound Name | 1-O-[2-[(1R)-1-(3-amino-4-oxoquinazolin-2-yl)ethoxy]ethyl] 7-O-methyl (6S)-2-methylidene-6-(phenylmethoxycarbonylamino)heptanedioate |
|---|---|
| PubChem CID | 11534241 |
| Molecular Formula | C29H34N4O8 |
| Molecular Weight | 566.61 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 1-O-[2-[(1R)-1-(3-amino-4-oxoquinazolin-2-yl)ethoxy]ethyl] 7-O-methyl (6S)-2-methylidene-6-(phenylmethoxycarbonylamino)heptanedioate |
| SMILES | C=C(CCC[C@H](NC(=O)OCc1ccccc1)C(=O)OC)C(=O)OCCO[C@H](C)c1nc2ccccc2c(=O)n1N |
| InChI | InChI=1S/C29H34N4O8/c1-19(10-9-15-24(28(36)38-3)32-29(37)41-18-21-11-5-4-6-12-21)27(35)40-17-16-39-20(2)25-31-23-14-8-7-13-22(23)26(34)33(25)30/h4-8,11-14,20,24H,1,9-10,15-18,30H2,2-3H3,(H,32,37)/t20-,24+/m1/s1 |
| InChIKey | UEOFGLOKGGDHKG-YKSBVNFPSA-N |
| XLogP | 2.93 |
| TPSA | 161.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|