C11H20O2S2 — CID 115386079
1-(3-ethyl-1,4-dithian-2-yl)-2-propoxyethanone (PubChem CID 115386079) has the molecular formula C11H20O2S2 and a molecular weight of 248.41 g/mol. Its IUPAC name is 1-(3-ethyl-1,4-dithian-2-yl)-2-propoxyethanone.
| Compound Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-propoxyethanone |
|---|---|
| PubChem CID | 115386079 |
| Molecular Formula | C11H20O2S2 |
| Molecular Weight | 248.41 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 1-(3-ethyl-1,4-dithian-2-yl)-2-propoxyethanone |
| SMILES | CCCOCC(=O)C1SCCSC1CC |
| InChI | InChI=1S/C11H20O2S2/c1-3-5-13-8-9(12)11-10(4-2)14-6-7-15-11/h10-11H,3-8H2,1-2H3 |
| InChIKey | CMNMTEPKSNDVPL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|