C15H23NO4S — CID 11551395
tert-butyl N-[1-(benzenesulfonyl)-2-methylpropyl]carbamate (PubChem CID 11551395) has the molecular formula C15H23NO4S and a molecular weight of 313.42 g/mol. Its IUPAC name is tert-butyl N-[1-(benzenesulfonyl)-2-methylpropyl]carbamate.
| Compound Name | tert-butyl N-[1-(benzenesulfonyl)-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 11551395 |
| Molecular Formula | C15H23NO4S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | tert-butyl N-[1-(benzenesulfonyl)-2-methylpropyl]carbamate |
| SMILES | CC(C)C(NC(=O)OC(C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H23NO4S/c1-11(2)13(16-14(17)20-15(3,4)5)21(18,19)12-9-7-6-8-10-12/h6-11,13H,1-5H3,(H,16,17) |
| InChIKey | RHUSSAVCEINREK-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |