C11H13N3S2 — CID 115748774
6-ethylsulfanyl-N-(1,3-thiazol-4-ylmethyl)pyridin-3-amine (PubChem CID 115748774) has the molecular formula C11H13N3S2 and a molecular weight of 251.38 g/mol. Its IUPAC name is 6-ethylsulfanyl-N-(1,3-thiazol-4-ylmethyl)pyridin-3-amine.
| Compound Name | 6-ethylsulfanyl-N-(1,3-thiazol-4-ylmethyl)pyridin-3-amine |
|---|---|
| PubChem CID | 115748774 |
| Molecular Formula | C11H13N3S2 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 6-ethylsulfanyl-N-(1,3-thiazol-4-ylmethyl)pyridin-3-amine |
| SMILES | CCSc1ccc(NCc2cscn2)cn1 |
| InChI | InChI=1S/C11H13N3S2/c1-2-16-11-4-3-9(5-13-11)12-6-10-7-15-8-14-10/h3-5,7-8,12H,2,6H2,1H3 |
| InChIKey | PNKBCYKMIULFCF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |