C23H24IN4O3S+ — CID 11599393
2-[2-[(E)-2-[4-(diethylamino)-2,1,3-benzoxadiazol-7-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethyl 2-iodoacetate (PubChem CID 11599393) has the molecular formula C23H24IN4O3S+ and a molecular weight of 563.44 g/mol. Its IUPAC name is 2-[2-[(E)-2-[4-(diethylamino)-2,1,3-benzoxadiazol-7-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethyl 2-iodoacetate.
| Compound Name | 2-[2-[(E)-2-[4-(diethylamino)-2,1,3-benzoxadiazol-7-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethyl 2-iodoacetate |
|---|---|
| PubChem CID | 11599393 |
| Molecular Formula | C23H24IN4O3S+ |
| Molecular Weight | 563.44 g/mol |
| Exact Mass | 563.06 |
| IUPAC Name | 2-[2-[(E)-2-[4-(diethylamino)-2,1,3-benzoxadiazol-7-yl]ethenyl]-1,3-benzothiazol-3-ium-3-yl]ethyl 2-iodoacetate |
| SMILES | CCN(CC)c1ccc(/C=C/c2sc3ccccc3[n+]2CCOC(=O)CI)c2nonc12 |
| InChI | InChI=1S/C23H24IN4O3S/c1-3-27(4-2)18-11-9-16(22-23(18)26-31-25-22)10-12-20-28(13-14-30-21(29)15-24)17-7-5-6-8-19(17)32-20/h5-12H,3-4,13-15H2,1-2H3/q+1 |
| InChIKey | FUGYBYFHGUZGTQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 72.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|