C45H82O5Si3 — CID 11607442
[(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-2-(7-phenylmethoxyhept-2-ynyl)oxolan-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11607442) has the molecular formula C45H82O5Si3 and a molecular weight of 787.40 g/mol. Its IUPAC name is [(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-2-(7-phenylmethoxyhept-2-ynyl)oxolan-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-2-(7-phenylmethoxyhept-2-ynyl)oxolan-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11607442 |
| Molecular Formula | C45H82O5Si3 |
| Molecular Weight | 787.40 g/mol |
| Exact Mass | 786.55 |
| IUPAC Name | [(2S,3S,5S)-5-[(E,1R,4S)-1,4-bis[[tert-butyl(dimethyl)silyl]oxy]non-2-enyl]-2-(7-phenylmethoxyhept-2-ynyl)oxolan-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCC[C@@H](/C=C/[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CC#CCCCCOCc2ccccc2)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C45H82O5Si3/c1-17-18-23-30-38(48-51(11,12)43(2,3)4)32-33-40(49-52(13,14)44(5,6)7)41-35-42(50-53(15,16)45(8,9)10)39(47-41)31-26-20-19-21-27-34-46-36-37-28-24-22-25-29-37/h22,24-25,28-29,32-33,38-42H,17-19,21,23,27,30-31,34-36H2,1-16H3/b33-32+/t38-,39-,40+,41-,42-/m0/s1 |
| InChIKey | YOCWNFDBAKGHDF-JBPPHPFPSA-N |
| XLogP | 13.23 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.40 |
| LogP ≤ 5 | 13.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|