C19H44N6 — CID 11617376
N'-[(E)-4-[4-aminobutyl(3-aminopropyl)amino]but-2-enyl]-N'-(3-aminopropyl)pentane-1,5-diamine (PubChem CID 11617376) has the molecular formula C19H44N6 and a molecular weight of 356.60 g/mol. Its IUPAC name is N'-[(E)-4-[4-aminobutyl(3-aminopropyl)amino]but-2-enyl]-N'-(3-aminopropyl)pentane-1,5-diamine.
| Compound Name | N'-[(E)-4-[4-aminobutyl(3-aminopropyl)amino]but-2-enyl]-N'-(3-aminopropyl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 11617376 |
| Molecular Formula | C19H44N6 |
| Molecular Weight | 356.60 g/mol |
| Exact Mass | 356.36 |
| IUPAC Name | N'-[(E)-4-[4-aminobutyl(3-aminopropyl)amino]but-2-enyl]-N'-(3-aminopropyl)pentane-1,5-diamine |
| SMILES | NCCCCCN(C/C=C/CN(CCCN)CCCCN)CCCN |
| InChI | InChI=1S/C19H44N6/c20-10-2-1-4-14-24(18-8-12-22)16-6-7-17-25(19-9-13-23)15-5-3-11-21/h6-7H,1-5,8-23H2/b7-6+ |
| InChIKey | CFBBKXOHGPAWMN-VOTSOKGWSA-N |
| XLogP | 0.71 |
| TPSA | 110.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.60 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|