C19H20N6O — CID 11653165
5-methyl-2-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-[1,2,4]triazolo[1,5-a]pyridine (PubChem CID 11653165) has the molecular formula C19H20N6O and a molecular weight of 348.41 g/mol. Its IUPAC name is 5-methyl-2-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-[1,2,4]triazolo[1,5-a]pyridine.
| Compound Name | 5-methyl-2-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-[1,2,4]triazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 11653165 |
| Molecular Formula | C19H20N6O |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 5-methyl-2-[4-[4-(1,2,4-triazol-1-yl)butoxy]phenyl]-[1,2,4]triazolo[1,5-a]pyridine |
| SMILES | Cc1cccc2nc(-c3ccc(OCCCCn4cncn4)cc3)nn12 |
| InChI | InChI=1S/C19H20N6O/c1-15-5-4-6-18-22-19(23-25(15)18)16-7-9-17(10-8-16)26-12-3-2-11-24-14-20-13-21-24/h4-10,13-14H,2-3,11-12H2,1H3 |
| InChIKey | GOFULCMLORHWLY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|