C29H43BOSi — CID 11662339
[5-(9-borabicyclo[3.3.1]nonan-9-yl)-1,1-dideuteriopentoxy]-tert-butyl-diphenylsilane (PubChem CID 11662339) has the molecular formula C29H43BOSi and a molecular weight of 448.57 g/mol. Its IUPAC name is [5-(9-borabicyclo[3.3.1]nonan-9-yl)-1,1-dideuteriopentoxy]-tert-butyl-diphenylsilane.
| Compound Name | [5-(9-borabicyclo[3.3.1]nonan-9-yl)-1,1-dideuteriopentoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 11662339 |
| Molecular Formula | C29H43BOSi |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.33 |
| IUPAC Name | [5-(9-borabicyclo[3.3.1]nonan-9-yl)-1,1-dideuteriopentoxy]-tert-butyl-diphenylsilane |
| SMILES | [2H]C([2H])(CCCCB1C2CCCC1CCC2)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H43BOSi/c1-29(2,3)32(27-19-7-4-8-20-27,28-21-9-5-10-22-28)31-24-12-6-11-23-30-25-15-13-16-26(30)18-14-17-25/h4-5,7-10,19-22,25-26H,6,11-18,23-24H2,1-3H3/i24D2 |
| InChIKey | DQQQSSUVKWGIPU-XRAPWQDJSA-N |
| XLogP | 7.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|