C24H15I2NO5 — CID 11664630
[2-(2-iodophenyl)-2-oxoethyl] 3-hydroxy-2-(2-iodophenyl)-4-oxo-1H-quinoline-7-carboxylate (PubChem CID 11664630) has the molecular formula C24H15I2NO5 and a molecular weight of 651.19 g/mol. Its IUPAC name is [2-(2-iodophenyl)-2-oxoethyl] 3-hydroxy-2-(2-iodophenyl)-4-oxo-1H-quinoline-7-carboxylate.
| Compound Name | [2-(2-iodophenyl)-2-oxoethyl] 3-hydroxy-2-(2-iodophenyl)-4-oxo-1H-quinoline-7-carboxylate |
|---|---|
| PubChem CID | 11664630 |
| Molecular Formula | C24H15I2NO5 |
| Molecular Weight | 651.19 g/mol |
| Exact Mass | 650.90 |
| IUPAC Name | [2-(2-iodophenyl)-2-oxoethyl] 3-hydroxy-2-(2-iodophenyl)-4-oxo-1H-quinoline-7-carboxylate |
| SMILES | O=C(OCC(=O)c1ccccc1I)c1ccc2c(=O)c(O)c(-c3ccccc3I)[nH]c2c1 |
| InChI | InChI=1S/C24H15I2NO5/c25-17-7-3-1-5-14(17)20(28)12-32-24(31)13-9-10-16-19(11-13)27-21(23(30)22(16)29)15-6-2-4-8-18(15)26/h1-11,30H,12H2,(H,27,29) |
| InChIKey | HXFWDSGSJYHDCX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 96.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.19 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|