C28H21N7O — CID 11670022
4-[[9-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-8-(furan-2-yl)-6-methylpurin-2-yl]amino]benzonitrile (PubChem CID 11670022) has the molecular formula C28H21N7O and a molecular weight of 471.52 g/mol. Its IUPAC name is 4-[[9-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-8-(furan-2-yl)-6-methylpurin-2-yl]amino]benzonitrile.
| Compound Name | 4-[[9-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-8-(furan-2-yl)-6-methylpurin-2-yl]amino]benzonitrile |
|---|---|
| PubChem CID | 11670022 |
| Molecular Formula | C28H21N7O |
| Molecular Weight | 471.52 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 4-[[9-[4-[(E)-2-cyanoethenyl]-2,6-dimethylphenyl]-8-(furan-2-yl)-6-methylpurin-2-yl]amino]benzonitrile |
| SMILES | Cc1cc(/C=C/C#N)cc(C)c1-n1c(-c2ccco2)nc2c(C)nc(Nc3ccc(C#N)cc3)nc21 |
| InChI | InChI=1S/C28H21N7O/c1-17-14-21(6-4-12-29)15-18(2)25(17)35-26(23-7-5-13-36-23)33-24-19(3)31-28(34-27(24)35)32-22-10-8-20(16-30)9-11-22/h4-11,13-15H,1-3H3,(H,31,32,34)/b6-4+ |
| InChIKey | LVRBHCYXWNVGGM-GQCTYLIASA-N |
| XLogP | 6.15 |
| TPSA | 116.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.52 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|