C14H21N5O3S — CID 11688672
prop-2-enyl (2S,4S)-2-[[amino(5,6-dihydro-4H-pyrimidin-1-yl)methylidene]carbamoyl]-4-sulfanylpyrrolidine-1-carboxylate (PubChem CID 11688672) has the molecular formula C14H21N5O3S and a molecular weight of 339.42 g/mol. Its IUPAC name is prop-2-enyl (2S,4S)-2-[[amino(5,6-dihydro-4H-pyrimidin-1-yl)methylidene]carbamoyl]-4-sulfanylpyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (2S,4S)-2-[[amino(5,6-dihydro-4H-pyrimidin-1-yl)methylidene]carbamoyl]-4-sulfanylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 11688672 |
| Molecular Formula | C14H21N5O3S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | prop-2-enyl (2S,4S)-2-[[amino(5,6-dihydro-4H-pyrimidin-1-yl)methylidene]carbamoyl]-4-sulfanylpyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C[C@@H](S)C[C@H]1C(=O)/N=C(\N)N1C=NCCC1 |
| InChI | InChI=1S/C14H21N5O3S/c1-2-6-22-14(21)19-8-10(23)7-11(19)12(20)17-13(15)18-5-3-4-16-9-18/h2,9-11,23H,1,3-8H2,(H2,15,17,20)/t10-,11-/m0/s1 |
| InChIKey | FOQUZOHQULZUEO-QWRGUYRKSA-N |
| XLogP | 0.26 |
| TPSA | 100.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|