C38H60O7Si2 — CID 11693247
2-[(2R,3R,4R,4aS,6S,7R,8aS)-4a-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetaldehyde (PubChem CID 11693247) has the molecular formula C38H60O7Si2 and a molecular weight of 685.06 g/mol. Its IUPAC name is 2-[(2R,3R,4R,4aS,6S,7R,8aS)-4a-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetaldehyde.
| Compound Name | 2-[(2R,3R,4R,4aS,6S,7R,8aS)-4a-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetaldehyde |
|---|---|
| PubChem CID | 11693247 |
| Molecular Formula | C38H60O7Si2 |
| Molecular Weight | 685.06 g/mol |
| Exact Mass | 684.39 |
| IUPAC Name | 2-[(2R,3R,4R,4aS,6S,7R,8aS)-4a-methyl-7-phenylmethoxy-6-(phenylmethoxymethyl)-3,4-bis(triethylsilyloxy)-3,4,6,7,8,8a-hexahydro-2H-pyrano[3,2-b]pyran-2-yl]acetaldehyde |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](O[Si](CC)(CC)CC)[C@@]2(C)O[C@@H](COCc3ccccc3)[C@H](OCc3ccccc3)C[C@@H]2O[C@@H]1CC=O |
| InChI | InChI=1S/C38H60O7Si2/c1-8-46(9-2,10-3)44-36-32(24-25-39)42-35-26-33(41-28-31-22-18-15-19-23-31)34(29-40-27-30-20-16-14-17-21-30)43-38(35,7)37(36)45-47(11-4,12-5)13-6/h14-23,25,32-37H,8-13,24,26-29H2,1-7H3/t32-,33-,34+,35+,36-,37-,38+/m1/s1 |
| InChIKey | YSGTYIKGLSIAQA-MDSHBQSDSA-N |
| XLogP | 8.47 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.06 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|