C22H27ClN2O3 — CID 117069078
methyl 5-[4-(1,4-dihydroquinazolin-2-yl)phenoxy]-2,2-dimethylpentanoate;hydrochloride (PubChem CID 117069078) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is methyl 5-[4-(1,4-dihydroquinazolin-2-yl)phenoxy]-2,2-dimethylpentanoate;hydrochloride.
| Compound Name | methyl 5-[4-(1,4-dihydroquinazolin-2-yl)phenoxy]-2,2-dimethylpentanoate;hydrochloride |
|---|---|
| PubChem CID | 117069078 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | methyl 5-[4-(1,4-dihydroquinazolin-2-yl)phenoxy]-2,2-dimethylpentanoate;hydrochloride |
| SMILES | COC(=O)C(C)(C)CCCOc1ccc(C2=NCc3ccccc3N2)cc1.Cl |
| InChI | InChI=1S/C22H26N2O3.ClH/c1-22(2,21(25)26-3)13-6-14-27-18-11-9-16(10-12-18)20-23-15-17-7-4-5-8-19(17)24-20;/h4-5,7-12H,6,13-15H2,1-3H3,(H,23,24);1H |
| InChIKey | XCNDDDHSOMFUFZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|