C11H9Br3 — CID 117069834
1,9,10-tribromotricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 117069834) has the molecular formula C11H9Br3 and a molecular weight of 380.91 g/mol. Its IUPAC name is 1,9,10-tribromotricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | 1,9,10-tribromotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 117069834 |
| Molecular Formula | C11H9Br3 |
| Molecular Weight | 380.91 g/mol |
| Exact Mass | 377.83 |
| IUPAC Name | 1,9,10-tribromotricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | BrC1C2CC(Br)(c3ccccc32)C1Br |
| InChI | InChI=1S/C11H9Br3/c12-9-7-5-11(14,10(9)13)8-4-2-1-3-6(7)8/h1-4,7,9-10H,5H2 |
| InChIKey | KKWOYYHIDKQBPV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.91 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|