C11H8Br2 — CID 102348577
(1R,8R,11S)-1,11-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 102348577) has the molecular formula C11H8Br2 and a molecular weight of 299.99 g/mol. Its IUPAC name is (1R,8R,11S)-1,11-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | (1R,8R,11S)-1,11-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 102348577 |
| Molecular Formula | C11H8Br2 |
| Molecular Weight | 299.99 g/mol |
| Exact Mass | 297.90 |
| IUPAC Name | (1R,8R,11S)-1,11-dibromotricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | Br[C@H]1[C@@H]2C=C[C@@]1(Br)c1ccccc12 |
| InChI | InChI=1S/C11H8Br2/c12-10-8-5-6-11(10,13)9-4-2-1-3-7(8)9/h1-6,8,10H/t8-,10+,11-/m1/s1 |
| InChIKey | IFEDAERFUBYIMJ-DVVUODLYSA-N |
| XLogP | 3.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.99 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|