C29H38O7 — CID 117070762
2-[(3aR,5R,6R,6aR)-6-[(E)-2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethenyl]-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl acetate (PubChem CID 117070762) has the molecular formula C29H38O7 and a molecular weight of 498.62 g/mol. Its IUPAC name is 2-[(3aR,5R,6R,6aR)-6-[(E)-2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethenyl]-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl acetate.
| Compound Name | 2-[(3aR,5R,6R,6aR)-6-[(E)-2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethenyl]-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl acetate |
|---|---|
| PubChem CID | 117070762 |
| Molecular Formula | C29H38O7 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.26 |
| IUPAC Name | 2-[(3aR,5R,6R,6aR)-6-[(E)-2-(7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl)ethenyl]-2,2-dimethyl-6-phenylmethoxy-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]ethyl acetate |
| SMILES | CC(=O)OCC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@]1(/C=C/C12CCC(CC1=O)C2(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C29H38O7/c1-19(30)32-16-12-23-29(33-18-20-9-7-6-8-10-20,24-25(34-23)36-27(4,5)35-24)15-14-28-13-11-21(17-22(28)31)26(28,2)3/h6-10,14-15,21,23-25H,11-13,16-18H2,1-5H3/b15-14+/t21?,23-,24+,25-,28?,29-/m1/s1 |
| InChIKey | TUGYVTUKLUZLQF-KSNYAITMSA-N |
| XLogP | 4.72 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|