C19H33N7O — CID 117078910
4-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]cyclohexan-1-ol (PubChem CID 117078910) has the molecular formula C19H33N7O and a molecular weight of 375.52 g/mol. Its IUPAC name is 4-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]cyclohexan-1-ol.
| Compound Name | 4-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 117078910 |
| Molecular Formula | C19H33N7O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.27 |
| IUPAC Name | 4-[[6-[2-[di(propan-2-yl)amino]ethylamino]-7H-purin-2-yl]amino]cyclohexan-1-ol |
| SMILES | CC(C)N(CCNc1nc(NC2CCC(O)CC2)nc2nc[nH]c12)C(C)C |
| InChI | InChI=1S/C19H33N7O/c1-12(2)26(13(3)4)10-9-20-17-16-18(22-11-21-16)25-19(24-17)23-14-5-7-15(27)8-6-14/h11-15,27H,5-10H2,1-4H3,(H3,20,21,22,23,24,25) |
| InChIKey | GEGMTQMAUCRYTA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 101.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |