C21H20O3S — CID 11725566
2-(3,4-dimethoxyphenyl)-4-methyl-6-phenylsulfanylphenol (PubChem CID 11725566) has the molecular formula C21H20O3S and a molecular weight of 352.46 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-4-methyl-6-phenylsulfanylphenol.
| Compound Name | 2-(3,4-dimethoxyphenyl)-4-methyl-6-phenylsulfanylphenol |
|---|---|
| PubChem CID | 11725566 |
| Molecular Formula | C21H20O3S |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-4-methyl-6-phenylsulfanylphenol |
| SMILES | COc1ccc(-c2cc(C)cc(Sc3ccccc3)c2O)cc1OC |
| InChI | InChI=1S/C21H20O3S/c1-14-11-17(15-9-10-18(23-2)19(13-15)24-3)21(22)20(12-14)25-16-7-5-4-6-8-16/h4-13,22H,1-3H3 |
| InChIKey | OHNZQWYSPZNDPJ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |