C11H10N2 — CID 117275548
1,2-dihydrobenzo[cd]indol-6-amine (PubChem CID 117275548) has the molecular formula C11H10N2 and a molecular weight of 170.22 g/mol. Its IUPAC name is 1,2-dihydrobenzo[cd]indol-6-amine.
| Compound Name | 1,2-dihydrobenzo[cd]indol-6-amine |
|---|---|
| PubChem CID | 117275548 |
| Molecular Formula | C11H10N2 |
| Molecular Weight | 170.22 g/mol |
| Exact Mass | 170.08 |
| IUPAC Name | 1,2-dihydrobenzo[cd]indol-6-amine |
| SMILES | Nc1ccc2c3c(cccc13)CN2 |
| InChI | InChI=1S/C11H10N2/c12-9-4-5-10-11-7(6-13-10)2-1-3-8(9)11/h1-5,13H,6,12H2 |
| InChIKey | YIWKTIOATZOWRD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|