C8H9N3S — CID 84767958
8-amino-3,4-dihydro-1H-quinazoline-2-thione (PubChem CID 84767958) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is 8-amino-3,4-dihydro-1H-quinazoline-2-thione.
| Compound Name | 8-amino-3,4-dihydro-1H-quinazoline-2-thione |
|---|---|
| PubChem CID | 84767958 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | 8-amino-3,4-dihydro-1H-quinazoline-2-thione |
| SMILES | Nc1cccc2c1NC(=S)NC2 |
| InChI | InChI=1S/C8H9N3S/c9-6-3-1-2-5-4-10-8(12)11-7(5)6/h1-3H,4,9H2,(H2,10,11,12) |
| InChIKey | CDBUFXSFFAXJBC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|