C18H28N2O5S — CID 11728718
diethyl-methyl-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]azanium;4-methylbenzenesulfonate (PubChem CID 11728718) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is diethyl-methyl-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]azanium;4-methylbenzenesulfonate.
| Compound Name | diethyl-methyl-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11728718 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | diethyl-methyl-[2-oxo-2-(2-oxopyrrolidin-1-yl)ethyl]azanium;4-methylbenzenesulfonate |
| SMILES | CC[N+](C)(CC)CC(=O)N1CCCC1=O.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H21N2O2.C7H8O3S/c1-4-13(3,5-2)9-11(15)12-8-6-7-10(12)14;1-6-2-4-7(5-3-6)11(8,9)10/h4-9H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | IFRUWWCGHIXENQ-UHFFFAOYSA-M |
| XLogP | 1.52 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|