C12H14O4S — CID 11747170
(3S,4R,5R)-3-(benzenesulfonyl)-4,5-dimethyloxolan-2-one (PubChem CID 11747170) has the molecular formula C12H14O4S and a molecular weight of 254.31 g/mol. Its IUPAC name is (3S,4R,5R)-3-(benzenesulfonyl)-4,5-dimethyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-(benzenesulfonyl)-4,5-dimethyloxolan-2-one |
|---|---|
| PubChem CID | 11747170 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | (3S,4R,5R)-3-(benzenesulfonyl)-4,5-dimethyloxolan-2-one |
| SMILES | C[C@H]1[C@H](S(=O)(=O)c2ccccc2)C(=O)O[C@@H]1C |
| InChI | InChI=1S/C12H14O4S/c1-8-9(2)16-12(13)11(8)17(14,15)10-6-4-3-5-7-10/h3-9,11H,1-2H3/t8-,9-,11+/m1/s1 |
| InChIKey | QYGHQSYICADXRP-KKZNHRDASA-N |
| XLogP | 1.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |