C29H40O4S2 — CID 11756300
2-(4-hydroxyphenyl)-3-(10-pentylsulfonyldecyl)-1-benzothiophen-6-ol (PubChem CID 11756300) has the molecular formula C29H40O4S2 and a molecular weight of 516.77 g/mol. Its IUPAC name is 2-(4-hydroxyphenyl)-3-(10-pentylsulfonyldecyl)-1-benzothiophen-6-ol.
| Compound Name | 2-(4-hydroxyphenyl)-3-(10-pentylsulfonyldecyl)-1-benzothiophen-6-ol |
|---|---|
| PubChem CID | 11756300 |
| Molecular Formula | C29H40O4S2 |
| Molecular Weight | 516.77 g/mol |
| Exact Mass | 516.24 |
| IUPAC Name | 2-(4-hydroxyphenyl)-3-(10-pentylsulfonyldecyl)-1-benzothiophen-6-ol |
| SMILES | CCCCCS(=O)(=O)CCCCCCCCCCc1c(-c2ccc(O)cc2)sc2cc(O)ccc12 |
| InChI | InChI=1S/C29H40O4S2/c1-2-3-11-20-35(32,33)21-12-9-7-5-4-6-8-10-13-27-26-19-18-25(31)22-28(26)34-29(27)23-14-16-24(30)17-15-23/h14-19,22,30-31H,2-13,20-21H2,1H3 |
| InChIKey | SKEFTPMSBKDXFR-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.77 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|