C9H12F7O3P — CID 11759357
(E)-1-diethoxyphosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-ene (PubChem CID 11759357) has the molecular formula C9H12F7O3P and a molecular weight of 332.15 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-ene.
| Compound Name | (E)-1-diethoxyphosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-ene |
|---|---|
| PubChem CID | 11759357 |
| Molecular Formula | C9H12F7O3P |
| Molecular Weight | 332.15 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-3,3,4,4,5,5,5-heptafluoropent-1-ene |
| SMILES | CCOP(=O)(/C=C/C(F)(F)C(F)(F)C(F)(F)F)OCC |
| InChI | InChI=1S/C9H12F7O3P/c1-3-18-20(17,19-4-2)6-5-7(10,11)8(12,13)9(14,15)16/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChIKey | FSEQJIRTXOLWMZ-AATRIKPKSA-N |
| XLogP | 4.60 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.15 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|