C17H24F3NO — CID 11771444
2,2,2-Trifluoro-1-(2-pentyl-1-azaspiro[5.5]undeca-4,10-dien-1-yl)ethanone (PubChem CID 11771444) has the molecular formula C17H24F3NO and a molecular weight of 315.37 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2-pentyl-1-azaspiro[5.5]undeca-4,10-dien-1-yl)ethanone.
| Compound Name | 2,2,2-Trifluoro-1-(2-pentyl-1-azaspiro[5.5]undeca-4,10-dien-1-yl)ethanone |
|---|---|
| PubChem CID | 11771444 |
| Molecular Formula | C17H24F3NO |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | 2,2,2-trifluoro-1-(2-pentyl-1-azaspiro[5.5]undeca-4,10-dien-1-yl)ethanone |
| SMILES | CCCCCC1CC=CC2(N1C(=O)C(F)(F)F)CCCC=C2 |
| InChI | InChI=1S/C17H24F3NO/c1-2-3-5-9-14-10-8-13-16(11-6-4-7-12-16)21(14)15(22)17(18,19)20/h6,8,11,13-14H,2-5,7,9-10,12H2,1H3 |
| InChIKey | CXFNROYKDAXIFB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 20.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | 455 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|