C22H34F3NO — CID 101350532
N-[(7Z)-3-ethenylnona-1,7-dien-3-yl]-2,2,2-trifluoro-N-non-1-en-4-ylacetamide (PubChem CID 101350532) has the molecular formula C22H34F3NO and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[(7Z)-3-ethenylnona-1,7-dien-3-yl]-2,2,2-trifluoro-N-non-1-en-4-ylacetamide.
| Compound Name | N-[(7Z)-3-ethenylnona-1,7-dien-3-yl]-2,2,2-trifluoro-N-non-1-en-4-ylacetamide |
|---|---|
| PubChem CID | 101350532 |
| Molecular Formula | C22H34F3NO |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | N-[(7Z)-3-ethenylnona-1,7-dien-3-yl]-2,2,2-trifluoro-N-non-1-en-4-ylacetamide |
| SMILES | C=CCC(CCCCC)N(C(=O)C(F)(F)F)C(C=C)(C=C)CCC/C=C\C |
| InChI | InChI=1S/C22H34F3NO/c1-6-11-13-15-18-21(9-4,10-5)26(20(27)22(23,24)25)19(16-8-3)17-14-12-7-2/h6,8-11,19H,3-5,7,12-18H2,1-2H3/b11-6- |
| InChIKey | BZXJRJNBXQJKBE-WDZFZDKYSA-N |
| XLogP | 6.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|