C19H28F3NO — CID 101350533
1-(6-ethenyl-6-pent-4-enyl-2-pentyl-2,3-dihydropyridin-1-yl)-2,2,2-trifluoroethanone (PubChem CID 101350533) has the molecular formula C19H28F3NO and a molecular weight of 343.43 g/mol. Its IUPAC name is 1-(6-ethenyl-6-pent-4-enyl-2-pentyl-2,3-dihydropyridin-1-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(6-ethenyl-6-pent-4-enyl-2-pentyl-2,3-dihydropyridin-1-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 101350533 |
| Molecular Formula | C19H28F3NO |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.21 |
| IUPAC Name | 1-(6-ethenyl-6-pent-4-enyl-2-pentyl-2,3-dihydropyridin-1-yl)-2,2,2-trifluoroethanone |
| SMILES | C=CCCCC1(C=C)C=CCC(CCCCC)N1C(=O)C(F)(F)F |
| InChI | InChI=1S/C19H28F3NO/c1-4-7-9-12-16-13-11-15-18(6-3,14-10-8-5-2)23(16)17(24)19(20,21)22/h5-6,11,15-16H,2-4,7-10,12-14H2,1H3 |
| InChIKey | UVJWFIYDVVKXRP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|