About (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium
(1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium (PubChem CID 11775733) has the molecular formula C12H19N2O2+
and a molecular weight of 223.30 g/mol. Its IUPAC name is (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium.
Molecular Properties
| Compound Name | (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium |
| PubChem CID | 11775733 |
| Molecular Formula | C12H19N2O2+ |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium |
| SMILES | C=CCCCCCC(=O)CC/C(O)=C/[N+]#N |
| InChI | InChI=1S/C12H18N2O2/c1-2-3-4-5-6-7-11(15)8-9-12(16)10-14-13/h2,10H,1,3-9H2/p+1/b12-10- |
| InChIKey | AYTZHMSXGVLOMX-BENRWUELSA-O |
| XLogP | 3.72 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium?
The IUPAC name of (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium (CID 11775733) is (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium.
What is the SMILES notation for (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium?
The canonical SMILES for (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium is C=CCCCCCC(=O)CC/C(O)=C/[N+]#N.
What is the InChIKey of (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium?
The InChIKey is AYTZHMSXGVLOMX-BENRWUELSA-O. The full InChI is InChI=1S/C12H18N2O2/c1-2-3-4-5-6-7-11(15)8-9-12(16)10-14-13/h2,10H,1,3-9H2/p+1/b12-10-.
What are the key properties of (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium?
(1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium has a molecular weight of 223.30 g/mol, XLogP of 3.72, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1Z)-2-hydroxy-5-oxododeca-1,11-diene-1-diazonium is sourced from PubChem (CID 11775733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).