C32H25BrO6 — CID 11786607
methyl (1R,9R,10S,11R)-12-(4-bromobenzoyl)oxy-1-hydroxy-9,10-diphenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate (PubChem CID 11786607) has the molecular formula C32H25BrO6 and a molecular weight of 585.45 g/mol. Its IUPAC name is methyl (1R,9R,10S,11R)-12-(4-bromobenzoyl)oxy-1-hydroxy-9,10-diphenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate.
| Compound Name | methyl (1R,9R,10S,11R)-12-(4-bromobenzoyl)oxy-1-hydroxy-9,10-diphenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate |
|---|---|
| PubChem CID | 11786607 |
| Molecular Formula | C32H25BrO6 |
| Molecular Weight | 585.45 g/mol |
| Exact Mass | 584.08 |
| IUPAC Name | methyl (1R,9R,10S,11R)-12-(4-bromobenzoyl)oxy-1-hydroxy-9,10-diphenyl-8-oxatricyclo[7.2.1.02,7]dodeca-2,4,6-triene-11-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@@H](c2ccccc2)[C@]2(c3ccccc3)Oc3ccccc3[C@@]1(O)C2OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C32H25BrO6/c1-37-29(35)27-26(20-10-4-2-5-11-20)32(22-12-6-3-7-13-22)30(38-28(34)21-16-18-23(33)19-17-21)31(27,36)24-14-8-9-15-25(24)39-32/h2-19,26-27,30,36H,1H3/t26-,27+,30?,31+,32+/m1/s1 |
| InChIKey | AJLAVRCWQPROFA-YPYXBSEQSA-N |
| XLogP | 5.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |