C23H30O2S2 — CID 11795413
S-phenyl (2S,3S,4R)-3-hydroxy-2,4,7-trimethyl-4-phenylsulfanyloctanethioate (PubChem CID 11795413) has the molecular formula C23H30O2S2 and a molecular weight of 402.63 g/mol. Its IUPAC name is S-phenyl (2S,3S,4R)-3-hydroxy-2,4,7-trimethyl-4-phenylsulfanyloctanethioate.
| Compound Name | S-phenyl (2S,3S,4R)-3-hydroxy-2,4,7-trimethyl-4-phenylsulfanyloctanethioate |
|---|---|
| PubChem CID | 11795413 |
| Molecular Formula | C23H30O2S2 |
| Molecular Weight | 402.63 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | S-phenyl (2S,3S,4R)-3-hydroxy-2,4,7-trimethyl-4-phenylsulfanyloctanethioate |
| SMILES | CC(C)CC[C@@](C)(Sc1ccccc1)[C@@H](O)[C@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C23H30O2S2/c1-17(2)15-16-23(4,27-20-13-9-6-10-14-20)21(24)18(3)22(25)26-19-11-7-5-8-12-19/h5-14,17-18,21,24H,15-16H2,1-4H3/t18-,21-,23+/m0/s1 |
| InChIKey | BJLHYLAYNSRUFE-AVCGJXAMSA-N |
| XLogP | 6.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.63 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|