C24H22ClNOS — CID 11795706
1-[2-(4-chlorophenyl)-3,3-dimethyl-2-sulfanylaziridin-1-yl]-2,2-diphenylethanone (PubChem CID 11795706) has the molecular formula C24H22ClNOS and a molecular weight of 407.97 g/mol. Its IUPAC name is 1-[2-(4-chlorophenyl)-3,3-dimethyl-2-sulfanylaziridin-1-yl]-2,2-diphenylethanone.
| Compound Name | 1-[2-(4-chlorophenyl)-3,3-dimethyl-2-sulfanylaziridin-1-yl]-2,2-diphenylethanone |
|---|---|
| PubChem CID | 11795706 |
| Molecular Formula | C24H22ClNOS |
| Molecular Weight | 407.97 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 1-[2-(4-chlorophenyl)-3,3-dimethyl-2-sulfanylaziridin-1-yl]-2,2-diphenylethanone |
| SMILES | CC1(C)N(C(=O)C(c2ccccc2)c2ccccc2)C1(S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H22ClNOS/c1-23(2)24(28,19-13-15-20(25)16-14-19)26(23)22(27)21(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-16,21,28H,1-2H3 |
| InChIKey | BCISKUOLXBWYGJ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 20.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.97 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|