C26H25NO2S — CID 10645528
S-[1-(2,2-diphenylacetyl)-3,3-dimethyl-2-phenylaziridin-2-yl] ethanethioate (PubChem CID 10645528) has the molecular formula C26H25NO2S and a molecular weight of 415.56 g/mol. Its IUPAC name is S-[1-(2,2-diphenylacetyl)-3,3-dimethyl-2-phenylaziridin-2-yl] ethanethioate.
| Compound Name | S-[1-(2,2-diphenylacetyl)-3,3-dimethyl-2-phenylaziridin-2-yl] ethanethioate |
|---|---|
| PubChem CID | 10645528 |
| Molecular Formula | C26H25NO2S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | S-[1-(2,2-diphenylacetyl)-3,3-dimethyl-2-phenylaziridin-2-yl] ethanethioate |
| SMILES | CC(=O)SC1(c2ccccc2)N(C(=O)C(c2ccccc2)c2ccccc2)C1(C)C |
| InChI | InChI=1S/C26H25NO2S/c1-19(28)30-26(22-17-11-6-12-18-22)25(2,3)27(26)24(29)23(20-13-7-4-8-14-20)21-15-9-5-10-16-21/h4-18,23H,1-3H3 |
| InChIKey | KPRZLILTYPPTJF-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 37.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|