C17H16N2O2 — CID 118012068
1-(1,2-dihydroimidazol-3-yl)-2-hydroxy-2,2-diphenylethanone (PubChem CID 118012068) has the molecular formula C17H16N2O2 and a molecular weight of 280.33 g/mol. Its IUPAC name is 1-(1,2-dihydroimidazol-3-yl)-2-hydroxy-2,2-diphenylethanone.
| Compound Name | 1-(1,2-dihydroimidazol-3-yl)-2-hydroxy-2,2-diphenylethanone |
|---|---|
| PubChem CID | 118012068 |
| Molecular Formula | C17H16N2O2 |
| Molecular Weight | 280.33 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 1-(1,2-dihydroimidazol-3-yl)-2-hydroxy-2,2-diphenylethanone |
| SMILES | O=C(N1C=CNC1)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O2/c20-16(19-12-11-18-13-19)17(21,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-12,18,21H,13H2 |
| InChIKey | OJMCZSWBMCNWAO-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.33 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |