C9H13F3N2O2 — CID 118062459
1-ethyl-2,4-dimethyl-1H-imidazol-1-ium;2,2,2-trifluoroacetate (PubChem CID 118062459) has the molecular formula C9H13F3N2O2 and a molecular weight of 238.21 g/mol. Its IUPAC name is 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium;2,2,2-trifluoroacetate.
| Compound Name | 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118062459 |
| Molecular Formula | C9H13F3N2O2 |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 1-ethyl-2,4-dimethyl-1H-imidazol-1-ium;2,2,2-trifluoroacetate |
| SMILES | CC[NH+]1C=C(C)N=C1C.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H12N2.C2HF3O2/c1-4-9-5-6(2)8-7(9)3;3-2(4,5)1(6)7/h5H,4H2,1-3H3;(H,6,7) |
| InChIKey | NKAZZVMNBYXPOO-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 56.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |