C25H32O6 — CID 118082953
1-[7-tert-butyl-8,9-dihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]butane-1,3-dione (PubChem CID 118082953) has the molecular formula C25H32O6 and a molecular weight of 428.53 g/mol. Its IUPAC name is 1-[7-tert-butyl-8,9-dihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]butane-1,3-dione.
| Compound Name | 1-[7-tert-butyl-8,9-dihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]butane-1,3-dione |
|---|---|
| PubChem CID | 118082953 |
| Molecular Formula | C25H32O6 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.22 |
| IUPAC Name | 1-[7-tert-butyl-8,9-dihydroxy-3-(2-hydroxyethyl)-5-methyl-1-oxo-3,4,4a,10-tetrahydro-2H-anthracen-2-yl]butane-1,3-dione |
| SMILES | CC(=O)CC(=O)C1C(=O)C2=C(O)c3c(O)c(C(C)(C)C)cc(C)c3CC2CC1CCO |
| InChI | InChI=1S/C25H32O6/c1-12-8-17(25(3,4)5)22(29)21-16(12)11-15-10-14(6-7-26)19(18(28)9-13(2)27)23(30)20(15)24(21)31/h8,14-15,19,26,29,31H,6-7,9-11H2,1-5H3 |
| InChIKey | NJSPZOKQKZJSNE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|