C21H17FN2O3S2 — CID 118089276
(5E)-5-[[7-(3-fluoro-4-propan-2-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one (PubChem CID 118089276) has the molecular formula C21H17FN2O3S2 and a molecular weight of 428.51 g/mol. Its IUPAC name is (5E)-5-[[7-(3-fluoro-4-propan-2-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[7-(3-fluoro-4-propan-2-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 118089276 |
| Molecular Formula | C21H17FN2O3S2 |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.07 |
| IUPAC Name | (5E)-5-[[7-(3-fluoro-4-propan-2-yloxyphenyl)furo[3,2-c]pyridin-2-yl]methylidene]-2-methylsulfanyl-1,3-thiazol-4-one |
| SMILES | CSC1=NC(=O)/C(=C\c2cc3cncc(-c4ccc(OC(C)C)c(F)c4)c3o2)S1 |
| InChI | InChI=1S/C21H17FN2O3S2/c1-11(2)26-17-5-4-12(7-16(17)22)15-10-23-9-13-6-14(27-19(13)15)8-18-20(25)24-21(28-3)29-18/h4-11H,1-3H3/b18-8+ |
| InChIKey | YXTFYFMTGZLSAB-QGMBQPNBSA-N |
| XLogP | 5.75 |
| TPSA | 64.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|